* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO-2H-1-BENZOPYRAN-2-ONE |
| CAS: | 33491-30-4 |
| English Synonyms: | 8-BROMO-2H-CHROMEN-2-ONE ; 8-BROMO-2H-1-BENZOPYRAN-2-ONE |
| MDL Number.: | MFCD09999238 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc2ccc(=O)oc2c(c1)Br |
| InChi: | InChI=1S/C9H5BrO2/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1-5H |
| InChiKey: | InChIKey=BIVMXYHSBRLPDE-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.