* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,5-DICHLORO-4-(1,1,2,2-TETRAFLUOROETHOXY)ANILINE |
| CAS: | 104147-32-2 |
| English Synonyms: | 3,5-DICHLORO-4-(1,1,2,2-TETRAFLUOROETHOXY)ANILINE |
| MDL Number.: | MFCD10000640 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1c(cc(c(c1Cl)OC(C(F)F)(F)F)Cl)N |
| InChi: | InChI=1S/C8H5Cl2F4NO/c9-4-1-3(15)2-5(10)6(4)16-8(13,14)7(11)12/h1-2,7H,15H2 |
| InChiKey: | InChIKey=JIPDPVQPKLVDIU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.