* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-AMINO-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE |
| CAS: | 337463-65-7 |
| English Synonyms: | 6-AMINO-2H,3H,4H-PYRIDO[3,2-B][1,4]OXAZIN-3-ONE ; ABBYPHARMA AP-11-10019 ; 6-AMINO-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE ; 2H-PYRIDO[3,2-B]-1,4-OXAZIN-3(4H)-ONE, 6-AMINO- |
| MDL Number.: | MFCD10000807 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1cc(nc2c1OCC(=O)N2)N |
| InChi: | InChI=1S/C7H7N3O2/c8-5-2-1-4-7(9-5)10-6(11)3-12-4/h1-2H,3H2,(H3,8,9,10,11) |
| InChiKey: | InChIKey=RIOMUKYDWGTOAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.