* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DI-TS-INTERMEDIATE |
English Synonyms: | DI-TS-INTERMEDIATE |
MDL Number.: | MFCD10001450 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1)S(=O)(=O)O[C@@H]2C[C@](C[C@@H]3[C@H]2OC4(O3)CCCCC4)(O)OS(=O)(=O)c5ccc(cc5)C |
InChi: | InChI=1S/C26H32O9S2/c1-18-6-10-20(11-7-18)36(28,29)34-23-17-25(27,35-37(30,31)21-12-8-19(2)9-13-21)16-22-24(23)33-26(32-22)14-4-3-5-15-26/h6-13,22-24,27H,3-5,14-17H2,1-2H3/t22-,23-,24-,25-/m1/s1 |
InChiKey: | InChIKey=IOVAGUNDUSLNDF-ZGFBMJKBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.