* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC639454 |
| English Synonyms: | BCH-RESEARCH BC639454 |
| MDL Number.: | MFCD10007466 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)ccc3c2nc4c(c3Cl)CCC4 |
| InChi: | InChI=1S/C16H12ClN/c17-15-12-6-3-7-14(12)18-16-11-5-2-1-4-10(11)8-9-13(15)16/h1-2,4-5,8-9H,3,6-7H2 |
| InChiKey: | InChIKey=JKYFJNOFOAAETD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.