* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10780984 |
English Synonyms: | SELENA SEL10780984 |
MDL Number.: | MFCD10017501 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc(sc1)S(=O)(=O)NCC(=O)N2CCNCC2 |
InChi: | InChI=1S/C10H15N3O3S2/c14-9(13-5-3-11-4-6-13)8-12-18(15,16)10-2-1-7-17-10/h1-2,7,11-12H,3-6,8H2 |
InChiKey: | InChIKey=JWDKSBOOHVRONJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.