* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC278120 |
| English Synonyms: | BCH-RESEARCH BC278120 |
| MDL Number.: | MFCD10028393 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)N(CCC(=O)O)C(=O)C2CC2 |
| InChi: | InChI=1S/C14H17NO3/c1-10-2-6-12(7-3-10)15(9-8-13(16)17)14(18)11-4-5-11/h2-3,6-7,11H,4-5,8-9H2,1H3,(H,16,17) |
| InChiKey: | InChIKey=PLRBNVHVZZVMHS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.