* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TIMTEC-BB SBB044211 |
English Synonyms: | TIMTEC-BB SBB044211 |
MDL Number.: | MFCD10044553 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1)N2CC(CC2=O)c3nc4ccccc4n3CC(=O)NC(C)C |
InChi: | InChI=1S/C23H26N4O2/c1-15(2)24-21(28)14-27-20-7-5-4-6-19(20)25-23(27)17-12-22(29)26(13-17)18-10-8-16(3)9-11-18/h4-11,15,17H,12-14H2,1-3H3,(H,24,28) |
InChiKey: | InChIKey=JLMVPTUESQKEBP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.