* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TIMTEC-BB SBB044673 |
English Synonyms: | TIMTEC-BB SBB044673 |
MDL Number.: | MFCD10044569 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc(ccc1Cl)OCCSc2nc3ccccc3n2CC(=O)NC4CC4 |
InChi: | InChI=1S/C21H22ClN3O2S/c1-14-12-16(8-9-17(14)22)27-10-11-28-21-24-18-4-2-3-5-19(18)25(21)13-20(26)23-15-6-7-15/h2-5,8-9,12,15H,6-7,10-11,13H2,1H3,(H,23,26) |
InChiKey: | InChIKey=WSXPCGVWLJRZHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.