* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | TIMTEC-BB SBB044674 |
English Synonyms: | TIMTEC-BB SBB044674 |
MDL Number.: | MFCD10044570 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | Cc1cc(ccc1Cl)OCCSc2nc3ccccc3n2CC(=O)N4CCOCC4 |
InChi: | InChI=1S/C22H24ClN3O3S/c1-16-14-17(6-7-18(16)23)29-12-13-30-22-24-19-4-2-3-5-20(19)26(22)15-21(27)25-8-10-28-11-9-25/h2-7,14H,8-13,15H2,1H3 |
InChiKey: | InChIKey=IRGCIOOIGNOHFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.