* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10462021 |
English Synonyms: | SELENA SEL10462021 |
MDL Number.: | MFCD10044970 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1Cl)S(=O)(=O)N(CCO)CCO)Cl |
InChi: | InChI=1S/C10H13Cl2NO4S/c11-8-1-2-9(12)10(7-8)18(16,17)13(3-5-14)4-6-15/h1-2,7,14-15H,3-6H2 |
InChiKey: | InChIKey=MTVPPTPAJIUJAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.