* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10461975 |
English Synonyms: | SELENA SEL10461975 |
MDL Number.: | MFCD10044975 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1C)S(=O)(=O)N(CCO)CCO |
InChi: | InChI=1S/C12H19NO4S/c1-10-3-4-12(9-11(10)2)18(16,17)13(5-7-14)6-8-15/h3-4,9,14-15H,5-8H2,1-2H3 |
InChiKey: | InChIKey=HYSYQEYMCVYBHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.