* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 879200 |
English Synonyms: | TOSLAB 879200 |
MDL Number.: | MFCD10479280 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1)NC(=O)CC2C(=O)N(c3n2c4ccccc4n3)C5CCCCC5 |
InChi: | InChI=1S/C24H26N4O3/c1-31-18-13-11-16(12-14-18)25-22(29)15-21-23(30)27(17-7-3-2-4-8-17)24-26-19-9-5-6-10-20(19)28(21)24/h5-6,9-14,17,21H,2-4,7-8,15H2,1H3,(H,25,29) |
InChiKey: | InChIKey=QPTLYHQDVOCJHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.