* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 879205 |
English Synonyms: | TOSLAB 879205 |
MDL Number.: | MFCD10479285 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)nc3n2C(C(=O)N3C4CCCCC4)CC(=O)Nc5ccc6c(c5)OCO6 |
InChi: | InChI=1S/C24H24N4O4/c29-22(25-15-10-11-20-21(12-15)32-14-31-20)13-19-23(30)27(16-6-2-1-3-7-16)24-26-17-8-4-5-9-18(17)28(19)24/h4-5,8-12,16,19H,1-3,6-7,13-14H2,(H,25,29) |
InChiKey: | InChIKey=KAUHKJPFTAVXCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.