* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 879212 |
English Synonyms: | TOSLAB 879212 |
MDL Number.: | MFCD10479292 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1)NC(=O)CC2C(=O)N(c3n2c4ccccc4n3)CCN5CCOCC5 |
InChi: | InChI=1S/C24H27N5O4/c1-32-18-8-6-17(7-9-18)25-22(30)16-21-23(31)28(11-10-27-12-14-33-15-13-27)24-26-19-4-2-3-5-20(19)29(21)24/h2-9,21H,10-16H2,1H3,(H,25,30) |
InChiKey: | InChIKey=MQOLPCZQINYPQO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.