* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 879226 |
English Synonyms: | TOSLAB 879226 |
MDL Number.: | MFCD10479306 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | CC(=O)Nc1ccc(cc1)NC(=O)CC2C(=O)N(c3n2c4ccccc4n3)CC5CCCO5 |
InChi: | InChI=1S/C24H25N5O4/c1-15(30)25-16-8-10-17(11-9-16)26-22(31)13-21-23(32)28(14-18-5-4-12-33-18)24-27-19-6-2-3-7-20(19)29(21)24/h2-3,6-11,18,21H,4-5,12-14H2,1H3,(H,25,30)(H,26,31) |
InChiKey: | InChIKey=CQJSBZLDDNZZPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.