* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TIMTEC-BB SBB044694 |
English Synonyms: | TIMTEC-BB SBB044694 |
MDL Number.: | MFCD10555308 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)nc(n2CC(=O)NC3CC3)SCCOc4ccccc4Cl |
InChi: | InChI=1S/C20H20ClN3O2S/c21-15-5-1-4-8-18(15)26-11-12-27-20-23-16-6-2-3-7-17(16)24(20)13-19(25)22-14-9-10-14/h1-8,14H,9-13H2,(H,22,25) |
InChiKey: | InChIKey=IKQPAWVVCMUMRP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.