* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BOC-3-(5-CHLOROTHIEN-3-YL)-L-ALANINE |
| CAS: | 190319-94-9 |
| English Synonyms: | BOC-3-(5-CHLOROTHIEN-3-YL)-L-ALANINE |
| MDL Number.: | MFCD10565735 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(s1)Cl)C(=O)O |
| InChi: | InChI=1S/C12H16ClNO4S/c1-12(2,3)18-11(17)14-8(10(15)16)6-7-4-5-9(13)19-7/h4-5,8H,6H2,1-3H3,(H,14,17)(H,15,16)/t8-/m0/s1 |
| InChiKey: | InChIKey=WFISWLYIBVMABO-QMMMGPOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.