* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYCINE CITRATE |
| CAS: | 32026-15-6 |
| English Synonyms: | GLYCINE CITRATE |
| MDL Number.: | MFCD10566443 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | C(CC(O)(C(=O)O)CC(=O)O)(=O)O.NCC(=O)O |
| InChi: | InChI=1S/C6H8O7.C2H5NO2/c7-3(8)1-6(13,5(11)12)2-4(9)10;3-1-2(4)5/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1,3H2,(H,4,5) |
| InChiKey: | InChIKey=YBHYYFYQHRADCQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.