* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-ARGININE L-MALATE |
CAS: | 93964-77-3 |
English Synonyms: | L-ARGININE L-MALATE(1:1) ; L-ARGININE L-MALATE ; L-ARGININE L-MALATE(1:1)/(2:1) |
MDL Number.: | MFCD10566446 |
H bond acceptor: | 6 |
H bond donor: | 5 |
Smile: | C(C[C@@H](C(=O)O)N)CNC(=N)N.C([C@@H](C(=O)O)O)C(=O)O |
InChi: | InChI=1S/C6H14N4O2.C4H6O5/c7-4(5(11)12)2-1-3-10-6(8)9;5-2(4(8)9)1-3(6)7/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2,5H,1H2,(H,6,7)(H,8,9)/t4-;2-/m00/s1 |
InChiKey: | InChIKey=RUFJTBOKWJYXPM-ZBRNBAAYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.