* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GINSENOSIDE RH3 |
| CAS: | 105558-26-7 |
| English Synonyms: | GINSENOSIDE RH3 ; (3BETA,12BETA,20Z)-12-HYDROXYDAMMARA-20(22),24-DIEN-3-YL |
| MDL Number.: | MFCD10566602 |
| H bond acceptor: | 7 |
| H bond donor: | 5 |
| Smile: | CC(=CC/C=C(/C)\[C@H]1CC[C@@]2([C@@H]1[C@@H](C[C@H]3[C@]2(CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)O)C)C |
| InChi: | InChI=1S/C36H60O7/c1-20(2)10-9-11-21(3)22-12-16-36(8)28(22)23(38)18-26-34(6)15-14-27(33(4,5)25(34)13-17-35(26,36)7)43-32-31(41)30(40)29(39)24(19-37)42-32/h10-11,22-32,37-41H,9,12-19H2,1-8H3/b21-11-/t22-,23-,24-,25+,26-,27+,28+,29-,30+,31-,32+,34+,35-,36-/m1/s1 |
| InChiKey: | InChIKey=PHLXREOMFNVWOH-YAGNRYSRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.