Molecular Structure:
CCD No.:CCD00949477
BSA (399-404)
Formula:C32 H42 N8 O10
MolWeight:698.73
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | BSA (399-404) |
| English Synonyms： | YGFQNA ; H-TYR-GLY-PHE-GLN-ASN-ALA-OH ; BSA (399-404) ; SERORPHIN |
| MDL Number.： | MFCD10567338 |
| H bond acceptor： | 18 |
| H bond donor： | 10 |
| Smile： | C[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](Cc2ccc(cc2)O)N |
| InChi： | InChI=1S/C32H42N8O10/c1-17(32(49)50)37-30(47)24(15-26(35)43)40-29(46)22(11-12-25(34)42)39-31(48)23(14-18-5-3-2-4-6-18)38-27(44)16-36-28(45)21(33)13-19-7-9-20(41)10-8-19/h2-10,17,21-24,41H,11-16,33H2,1H3,(H2,34,42)(H2,35,43)(H,36,45)(H,37,47)(H,38,44)(H,39,48)(H,40,46)(H,49,50)/t17-,21-,22-,23-,24-/m0/s1 |
| InChiKey： | InChIKey=AXZWCTXXPFEYQQ-KELSAIANSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
