* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-BENZYLOXY-2,3S-DIMETHYL-BUTAN-2-OL |
| CAS: | 93748-46-0 |
| English Synonyms: | 4-BENZYLOXY-2,3S-DIMETHYL-BUTAN-2-OL |
| MDL Number.: | MFCD10574763 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[C@@H](COCc1ccccc1)C(C)(C)O |
| InChi: | InChI=1S/C13H20O2/c1-11(13(2,3)14)9-15-10-12-7-5-4-6-8-12/h4-8,11,14H,9-10H2,1-3H3/t11-/m0/s1 |
| InChiKey: | InChIKey=NNAUPMPJOBBKDS-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.