* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,9-DIMETHOXY-3-AZABICYCLO[3.3.1]NONANE |
English Synonyms: | 9,9-DIMETHOXY-3-AZABICYCLO[3.3.1]NONANE |
MDL Number.: | MFCD10686956 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COC1([C@H]2CCC[C@@H]1CNC2)OC |
InChi: | InChI=1S/C10H19NO2/c1-12-10(13-2)8-4-3-5-9(10)7-11-6-8/h8-9,11H,3-7H2,1-2H3/t8-,9+ |
InChiKey: | InChIKey=JPEDLBXNIHZJTJ-DTORHVGOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.