* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | DNP-TEG CEP |
English Synonyms: | DNP-TEG CEP |
MDL Number.: | MFCD10686976 |
H bond acceptor: | 18 |
H bond donor: | 1 |
Smile: | CC(C)N(C(C)C)P(OCCC#N)OC(COCCOCCOCCOCCCNc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])COC(c2ccccc2)(c3ccc(cc3)OC)c4ccc(cc4)OC |
InChi: | InChI=1S/C48H64N5O13P/c1-37(2)51(38(3)4)67(65-27-10-24-49)66-45(35-63-33-32-62-31-30-61-29-28-60-26-11-25-50-46-23-18-42(52(54)55)34-47(46)53(56)57)36-64-48(39-12-8-7-9-13-39,40-14-19-43(58-5)20-15-40)41-16-21-44(59-6)22-17-41/h7-9,12-23,34,37-38,45,50H,10-11,25-33,35-36H2,1-6H3 |
InChiKey: | InChIKey=QMUUCQCGRWITRM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.