* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-BROMO-5,6,7,8-TETRAHYDRO-IMIDAZO[1,5-A]PYRAZINE |
| CAS: | 944900-87-2 |
| English Synonyms: | 3-BROMO-5,6,7,8-TETRAHYDRO-IMIDAZO[1,5-A]PYRAZINE |
| MDL Number.: | MFCD10696289 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1c2n(c(n1)Br)CCNC2 |
| InChi: | InChI=1S/C6H8BrN3/c7-6-9-4-5-3-8-1-2-10(5)6/h4,8H,1-3H2 |
| InChiKey: | InChIKey=CRSLIIAXVGQLGJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.