* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-BROMO-4-METHYL-4H-1,2,4-TRIAZOLE |
| CAS: | 16681-73-5 |
| English Synonyms: | 3-BROMO-4-METHYL-1,2,4-TRIAZOLE ; 3-BROMO-4-METHYL-4H-1,2,4-TRIAZOLE ; 4H-1,2,4-TRIAZOLE, 3-BROMO-4-METHYL- |
| MDL Number.: | MFCD10696422 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cn1cnnc1Br |
| InChi: | InChI=1S/C3H4BrN3/c1-7-2-5-6-3(7)4/h2H,1H3 |
| InChiKey: | InChIKey=PYMVKLCRJYMSGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.