* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-AZABICYCLO[3.1.0]HEXANE |
CAS: | 285-59-6 |
English Synonyms: | 3-AZABICYCLO[3.1.0]HEXANE |
MDL Number.: | MFCD10696889 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1C2C1CNC2 |
InChi: | InChI=1S/C5H9N/c1-4-2-6-3-5(1)4/h4-6H,1-3H2 |
InChiKey: | InChIKey=HGWUUOXXAIISDB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.