* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-DECYLPHENOL |
| CAS: | 2985-57-1 |
| English Synonyms: | 4-DECYLPHENOL ; 4-N-DECYLPHENOL |
| MDL Number.: | MFCD10698711 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCCCCCCCCc1ccc(cc1)O |
| InChi: | InChI=1S/C16H26O/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15/h11-14,17H,2-10H2,1H3 |
| InChiKey: | InChIKey=CGTLMVREWQIWEC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.