* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO[1,2,4]TRIAZOLO[1,5-A]PYRIDINE |
| CAS: | 868362-18-9 |
| English Synonyms: | 8-BROMO[1,2,4]TRIAZOLO[1,5-A]PYRIDINE ; [1,2,4]TRIAZOLO[1,5-A]PYRIDINE, 8-BROMO- |
| MDL Number.: | MFCD10699199 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(c2ncnn2c1)Br |
| InChi: | InChI=1S/C6H4BrN3/c7-5-2-1-3-10-6(5)8-4-9-10/h1-4H |
| InChiKey: | InChIKey=NATZWIFAAIXCTQ-UHFFFAOYSA-N |
|
|
| Melting Point: | 152-157 DEG C |
| Comments: | WGK: 3 |
|
|
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.