* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(3-NITROPHENYL)-5-PROPYL-1,2,4-OXADIAZOLE |
| CAS: | 1033202-02-6 |
| English Synonyms: | 3-(3-NITROPHENYL)-5-PROPYL-1,2,4-OXADIAZOLE |
| MDL Number.: | MFCD10699666 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCCc1nc(no1)c2cccc(c2)[N+](=O)[O-] |
| InChi: | InChI=1S/C11H11N3O3/c1-2-4-10-12-11(13-17-10)8-5-3-6-9(7-8)14(15)16/h3,5-7H,2,4H2,1H3 |
| InChiKey: | InChIKey=WRRZRQYMFZIGHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.