* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-(3-BROMOPHENYL)-1,2,4-OXADIAZOLE |
CAS: | 1033202-12-8 |
English Synonyms: | 3-(3-BROMOPHENYL)-1,2,4-OXADIAZOLE |
MDL Number.: | MFCD10699671 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(cc(c1)Br)c2ncon2 |
InChi: | InChI=1S/C8H5BrN2O/c9-7-3-1-2-6(4-7)8-10-5-12-11-8/h1-5H |
InChiKey: | InChIKey=NJOGUMIPSJIRBL-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.