* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BICYCLO[2.2.1]HEPT-5-EN-2-AMINE |
| English Synonyms: | BICYCLO[2.2.1]HEPT-5-EN-2-AMINE |
| MDL Number.: | MFCD10700222 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C1[C@H]2CC([C@@H]1C=C2)N |
| InChi: | InChI=1S/C7H11N/c8-7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4,8H2/t5-,6+,7?/m0/s1 |
| InChiKey: | InChIKey=CYMRDAUUJQRTGL-GFCOJPQKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.