* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC372662 |
| English Synonyms: | BCH-RESEARCH BC372662 |
| MDL Number.: | MFCD10730204 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | C1CN(CCC1O)CC(=O)NC2CCS(=O)(=O)C2 |
| InChi: | InChI=1S/C11H20N2O4S/c14-10-1-4-13(5-2-10)7-11(15)12-9-3-6-18(16,17)8-9/h9-10,14H,1-8H2,(H,12,15) |
| InChiKey: | InChIKey=FBEHKWWCOYTVGO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.