* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC774701 |
| English Synonyms: | BCH-RESEARCH BC774701 |
| MDL Number.: | MFCD10892254 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCNC(=O)CNC(=O)c1ccc(cc1)Br |
| InChi: | InChI=1S/C11H13BrN2O2/c1-2-13-10(15)7-14-11(16)8-3-5-9(12)6-4-8/h3-6H,2,7H2,1H3,(H,13,15)(H,14,16) |
| InChiKey: | InChIKey=NYMLYNJYQSWSPD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.