Molecular Structure:
CCD No.:CCD00963529
SELENA SEL10862218
Formula:C11 H13 I N2 O2
MolWeight:332.136
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10862218 |
| English Synonyms： | SELENA SEL10862218 |
| MDL Number.： | MFCD10892289 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | CCNC(=O)CNC(=O)c1cccc(c1)I |
| InChi： | InChI=1S/C11H13IN2O2/c1-2-13-10(15)7-14-11(16)8-4-3-5-9(12)6-8/h3-6H,2,7H2,1H3,(H,13,15)(H,14,16) |
| InChiKey： | InChIKey=VHMAYEDTXOIDJE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
