* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(2,4-DIMETHYLPHENYL)-2-METHYL-9H-PYRIMIDO[4,5-B]INDOL-4-OL |
English Synonyms: | 9-(2,4-DIMETHYLPHENYL)-2-METHYL-9H-PYRIMIDO[4,5-B]INDOL-4-OL |
MDL Number.: | MFCD11043853 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)C)n2c3ccccc3c4c2nc(nc4O)C |
InChi: | InChI=1S/C19H17N3O/c1-11-8-9-15(12(2)10-11)22-16-7-5-4-6-14(16)17-18(22)20-13(3)21-19(17)23/h4-10H,1-3H3,(H,20,21,23) |
InChiKey: | InChIKey=ADVUIERZUSHIQX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.