* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINAZOLINE, 4,6-DICHLORO-2-(4-MORPHOLINYL)- |
| CAS: | 60973-44-6 |
| English Synonyms: | QUINAZOLINE, 4,6-DICHLORO-2-(4-MORPHOLINYL)- |
| MDL Number.: | MFCD11044651 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1Cl)c(nc(n2)N3CCOCC3)Cl |
| InChi: | InChI=1S/C12H11Cl2N3O/c13-8-1-2-10-9(7-8)11(14)16-12(15-10)17-3-5-18-6-4-17/h1-2,7H,3-6H2 |
| InChiKey: | InChIKey=JOBJUXHVJUMYQK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.