* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 10,10'-DIBROMO-9,9'-BIANTHRYL |
CAS: | 121848-75-7 |
English Synonyms: | 10,10'-DIBROMO-9,9'-BIANTHRYL ; 10,10'-DIBROMO-9,9'-BIANTHRACENE ; 10,10-DIBROMO-9,9-BIANTHRYL |
MDL Number.: | MFCD11045035 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)c(c3ccccc3c2Br)c4c5ccccc5c(c6c4cccc6)Br |
InChi: | InChI=1S/C28H16Br2/c29-27-21-13-5-1-9-17(21)25(18-10-2-6-14-22(18)27)26-19-11-3-7-15-23(19)28(30)24-16-8-4-12-20(24)26/h1-16H |
InChiKey: | InChIKey=NPNNLGXEAGTSRN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.