* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DAR-4M |
English Synonyms: | DIAMINORHODAMINE-4M ; DAR-4M |
MDL Number.: | MFCD11045858 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CNc1ccc(c(c1N)C(=O)[O-])c2c3ccc(cc3[o+]c4c2ccc(c4)N(C)C)N(C)C |
InChi: | InChI=1S/C25H26N4O3/c1-27-19-11-10-18(23(24(19)26)25(30)31)22-16-8-6-14(28(2)3)12-20(16)32-21-13-15(29(4)5)7-9-17(21)22/h6-13,27H,26H2,1-5H3 |
InChiKey: | InChIKey=LNDSYTUQQCXPAM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.