* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BENZYL-3,3A,9,9A-TETRAHYDRO-2H-BENZO[E]FURO[3,2-B][1,4]THIAZINE |
English Synonyms: | 9-BENZYL-3,3A,9,9A-TETRAHYDRO-2H-BENZO[E]FURO[3,2-B][1,4]THIAZINE |
MDL Number.: | MFCD11046195 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)CN2c3ccccc3SC4C2OCC4 |
InChi: | InChI=1S/C17H17NOS/c1-2-6-13(7-3-1)12-18-14-8-4-5-9-15(14)20-16-10-11-19-17(16)18/h1-9,16-17H,10-12H2 |
InChiKey: | InChIKey=GPHAFLAQYXKJBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.