* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DROLOXIFENE HCL |
| CAS: | 83647-28-3 |
| English Synonyms: | DROLOXIFENE HCL |
| MDL Number.: | MFCD11046518 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC/C(=C(\c1ccc(cc1)OCCN(C)C)/c2cccc(c2)O)/c3ccccc3.Cl |
| InChi: | InChI=1S/C26H29NO2.ClH/c1-4-25(20-9-6-5-7-10-20)26(22-11-8-12-23(28)19-22)21-13-15-24(16-14-21)29-18-17-27(2)3;/h5-16,19,28H,4,17-18H2,1-3H3;1H/b26-25-; |
| InChiKey: | InChIKey=ZKYPENWLGZVNFN-OQKDUQJOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.