* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-AZATRICYCLO[6.2.1.0(2,7)]UNDECA-2,4,6-TRIEN-10-ONE |
| English Synonyms: | 9-AZATRICYCLO[6.2.1.0(2,7)]UNDECA-2,4,6-TRIEN-10-ONE |
| MDL Number.: | MFCD11046745 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)[C@@H]3C[C@H]2NC3=O |
| InChi: | InChI=1S/C10H9NO/c12-10-8-5-9(11-10)7-4-2-1-3-6(7)8/h1-4,8-9H,5H2,(H,11,12)/t8-,9+/m0/s1 |
| InChiKey: | InChIKey=AYQSFOUTNUTKNL-DTWKUNHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.