* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-CHLORO-2,3,4,5-TETRAHYDRO-1-BENZOTHIEPIN-5-AMINE |
| English Synonyms: | 9-CHLORO-2,3,4,5-TETRAHYDRO-1-BENZOTHIEPIN-5-AMINE |
| MDL Number.: | MFCD11104819 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1cc2c(c(c1)Cl)SCCCC2N |
| InChi: | InChI=1S/C10H12ClNS/c11-8-4-1-3-7-9(12)5-2-6-13-10(7)8/h1,3-4,9H,2,5-6,12H2 |
| InChiKey: | InChIKey=QIJCJWKLRCWROB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.