* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIMETHYL-(6-PIPERAZIN-1-YL-[1,2,4]TRIAZIN-3-YL)-AMINE |
| English Synonyms: | DIMETHYL-(6-PIPERAZIN-1-YL-[1,2,4]TRIAZIN-3-YL)-AMINE |
| MDL Number.: | MFCD11108307 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CN(C=1N=NC(=CN1)N1CCNCC1)C |
| InChi: | InChI=1S/C9H16N6/c1-14(2)9-11-7-8(12-13-9)15-5-3-10-4-6-15/h7,10H,3-6H2,1-2H3 |
| InChiKey: | InChIKey=ZQTKQFDNEHJJQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.