* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | D-ARABINOFURANOSE |
| CAS: | 41546-26-3 |
| English Synonyms: | D-ARABINOFURANOSE |
| MDL Number.: | MFCD11111580 |
| H bond acceptor: | 5 |
| H bond donor: | 4 |
| Smile: | C([C@@H]1[C@H]([C@@H](C(O1)O)O)O)O |
| InChi: | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4+,5?/m1/s1 |
| InChiKey: | InChIKey=HMFHBZSHGGEWLO-ZRMNMSDTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.