Molecular Structure:
CCD No.:CCD01021303
D3(RINGA) ISOADIANTANE
Formula:C29 H47 D3
MolWeight:401.732
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | D3(RINGA) ISOADIANTANE |
| English Synonyms： | D3(RINGA) ISOADIANTANE |
| MDL Number.： | MFCD11114533 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | [2H]C1C(C([C@@H]2CC[C@@]3([C@@H]([C@]2(C1[2H])C)CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@H]5CC)C)C)C)(C)C)[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
