* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(3-ISOPROPYL-[1,2,4]OXADIAZOL-5-YL)-2-PHENYL-ETHYLAMINE |
| English Synonyms: | 1-(3-ISOPROPYL-[1,2,4]OXADIAZOL-5-YL)-2-PHENYL-ETHYLAMINE ; 2-PHENYL-1-[3-(PROPAN-2-YL)-1,2,4-OXADIAZOL-5-YL]ETHAN-1-AMINE |
| MDL Number.: | MFCD11115993 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(C)c1nc(on1)C(Cc2ccccc2)N |
| InChi: | InChI=1S/C13H17N3O/c1-9(2)12-15-13(17-16-12)11(14)8-10-6-4-3-5-7-10/h3-7,9,11H,8,14H2,1-2H3 |
| InChiKey: | InChIKey=RTVQCDUKSSHJNA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.