* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-AMINO-1-[3-(3-METHYLPHENYL)-1,2,4-OXADIAZOL-5-YL]PROPAN-2-OL |
English Synonyms: | 1-AMINO-1-[3-(3-METHYLPHENYL)-1,2,4-OXADIAZOL-5-YL]PROPAN-2-OL |
MDL Number.: | MFCD11118914 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1cccc(c1)c2nc(on2)C(C(C)O)N |
InChi: | InChI=1S/C12H15N3O2/c1-7-4-3-5-9(6-7)11-14-12(17-15-11)10(13)8(2)16/h3-6,8,10,16H,13H2,1-2H3 |
InChiKey: | InChIKey=KRLVZAYXSAMXCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.