* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-AMINO-1-(3-CYCLOPROPYL-1,2,4-OXADIAZOL-5-YL)PROPAN-2-OL |
English Synonyms: | 1-AMINO-1-(3-CYCLOPROPYL-1,2,4-OXADIAZOL-5-YL)PROPAN-2-OL |
MDL Number.: | MFCD11119596 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(C(c1nc(no1)C2CC2)N)O |
InChi: | InChI=1S/C8H13N3O2/c1-4(12)6(9)8-10-7(11-13-8)5-2-3-5/h4-6,12H,2-3,9H2,1H3 |
InChiKey: | InChIKey=ZIBJTOZWKIZVDB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.